Wiley SpectraBase; SpectraBase Compound ID=HGRPUfPyEB
http://spectrabase.com/compound/HGRPUfPyEB (accessed Aug 05, 2020).

10A-METHYL-4A,9,10,10A-TETRAHYDROPHENANTHREN-1-(4H)-ONE
SpectraBase Compound ID HGRPUfPyEB
InChI InChI=1S/C15H16O/c1-15-10-9-11-5-2-3-6-12(11)13(15)7-4-8-14(15)16/h2-6,8,13H,7,9-10H2,1H3/t13-,15+/m0/s1
InChIKey CJQOLPKXVLCLOP-DZGCQCFKSA-N
Mol Weight 212.29 g/mol
Molecular Formula C15H16O
Exact Mass 212.120115 g/mol
Enantiomer InChIKey CJQOLPKXVLCLOP-HIFRSBDPSA-N