Wiley SpectraBase; SpectraBase Compound ID=HFGaecDUe6
http://spectrabase.com/compound/HFGaecDUe6 (accessed Aug 04, 2020).

(+/-)-6-(DIMETHYLAMINO)-9-{(3'-BETA,5'-BETA)-5'-(HYDROXYMETHYL)-1'-(2-PROPENYL)-PIPERIDIN-3'-YL]-PURINE
SpectraBase Compound ID HFGaecDUe6
InChI InChI=1S/C16H24N6O/c1-4-5-21-7-12(9-23)6-13(8-21)22-11-19-14-15(20(2)3)17-10-18-16(14)22/h4,10-13,23H,1,5-9H2,2-3H3/t12-,13+/m0/s1
InChIKey OLWRMUMFMRGZHF-QWHCGFSZSA-N
Mol Weight 316.41 g/mol
Molecular Formula C16H24N6O
Exact Mass 316.20116 g/mol
Enantiomer InChIKey OLWRMUMFMRGZHF-OLZOCXBDSA-N