Wiley SpectraBase; SpectraBase Compound ID=HDe4e6Hbjq
http://spectrabase.com/compound/HDe4e6Hbjq (accessed Aug 10, 2020).

4,6,7-TRIMETHYL-AURONE
SpectraBase Compound ID HDe4e6Hbjq
InChI InChI=1S/C18H16O2/c1-11-9-12(2)16-17(19)15(20-18(16)13(11)3)10-14-7-5-4-6-8-14/h4-10H,1-3H3/b15-10-
InChIKey GLAQRGDBEMGYJE-GDNBJRDFSA-N
Mol Weight 264.32 g/mol
Molecular Formula C18H16O2
Exact Mass 264.11503 g/mol