Wiley SpectraBase; SpectraBase Compound ID=HAgmMTPCxk
http://spectrabase.com/compound/HAgmMTPCxk (accessed Aug 10, 2020).

GARLICNIN-A;3,4-DIMETHYL-5-[4,5-DITHIA-(1E,7)-OCTA-DIENE]-TETRAHYDROTHIOPHENE-2-SULFOXIDE-S-OXIDE
SpectraBase Compound ID HAgmMTPCxk
InChI InChI=1S/C12H20O2S4/c1-4-7-15-16-8-5-6-11-9(2)10(3)12(17-13)18(11)14/h4-6,9-12,17H,1,7-8H2,2-3H3/b6-5+/t9-,10-,11+,12-,18?/m1/s1
InChIKey SDJRORUQKBPJJP-VKFQDKORSA-N
Mol Weight 324.5 g/mol
Molecular Formula C12H20O2S4
Exact Mass 324.034617 g/mol
Enantiomer InChIKey SDJRORUQKBPJJP-DZCVJSJASA-N