Wiley SpectraBase; SpectraBase Compound ID=H9K12nOkgY
http://spectrabase.com/compound/H9K12nOkgY (accessed Aug 05, 2020).

1,3,6-TRIHYDROXY-DECINE
SpectraBase Compound ID H9K12nOkgY
InChI InChI=1S/C10H18O3/c1-2-3-4-9(12)5-6-10(13)7-8-11/h9-13H,2-4,7-8H2,1H3/t9-,10-/m0/s1
InChIKey DLCTXXKSBPVAJA-UWVGGRQHSA-N
Mol Weight 186.25 g/mol
Molecular Formula C10H18O3
Exact Mass 186.125595 g/mol
Enantiomer InChIKey DLCTXXKSBPVAJA-NXEZZACHSA-N