Wiley SpectraBase; SpectraBase Compound ID=H8juDg4Dc4
http://spectrabase.com/compound/H8juDg4Dc4 (accessed Aug 08, 2020).

(2R,3R,4R,5R)-2-(AMINOCARBONYL)-3,4,5-TRIHYDROXY-PIPERIDINE
SpectraBase Compound ID H8juDg4Dc4
InChI InChI=1S/C6H12N2O4/c7-6(12)3-5(11)4(10)2(9)1-8-3/h2-5,8-11H,1H2,(H2,7,12)/t2-,3-,4-,5-/m1/s1
InChIKey HLDDJPYTAZJWIC-TXICZTDVSA-N
Mol Weight 176.17 g/mol
Molecular Formula C6H12N2O4
Exact Mass 176.079707 g/mol
Enantiomer InChIKey HLDDJPYTAZJWIC-FCAWWPLPSA-N