Wiley SpectraBase; SpectraBase Compound ID=H8N2B8QBCg
http://spectrabase.com/compound/H8N2B8QBCg (accessed Aug 05, 2020).

1-OXO-6-METHYL-1,3,3A,6A-TETRAHYDROCYCLOPENTA-[C]-FURAN
SpectraBase Compound ID H8N2B8QBCg
InChI InChI=1S/C8H10O2/c1-5-2-3-6-4-10-8(9)7(5)6/h2-3,5-7H,4H2,1H3/t5-,6+,7+/m1/s1
InChIKey FBFOAZNJGCSPMQ-VQVTYTSYSA-N
Mol Weight 138.17 g/mol
Molecular Formula C8H10O2
Exact Mass 138.06808 g/mol
Enantiomer InChIKey FBFOAZNJGCSPMQ-RRKCRQDMSA-N