Wiley SpectraBase; SpectraBase Compound ID=H8DsouVROn
http://spectrabase.com/compound/H8DsouVROn (accessed Sep 20, 2020).

3,4-dihydro-4-oxo-2H-1,3-benzoxazine-2-carboxylic acid, methyl ester
SpectraBase Compound ID H8DsouVROn
InChI InChI=1S/C10H9NO4/c1-14-10(13)9-11-8(12)6-4-2-3-5-7(6)15-9/h2-5,9H,1H3,(H,11,12)
InChIKey BYXWHYQAQIIEPP-UHFFFAOYSA-N
Mol Weight 207.18 g/mol
Molecular Formula C10H9NO4
Exact Mass 207.053158 g/mol