Wiley SpectraBase; SpectraBase Compound ID=H8B2WA13by
http://spectrabase.com/compound/H8B2WA13by (accessed Aug 12, 2020).

4'-[(o-aminophenyl)thio]-3'-nitroacetophenone
SpectraBase Compound ID H8B2WA13by
InChI InChI=1S/C14H12N2O3S/c1-9(17)10-6-7-14(12(8-10)16(18)19)20-13-5-3-2-4-11(13)15/h2-8H,15H2,1H3
InChIKey KQQWGWNTDJNMEF-UHFFFAOYSA-N
Mol Weight 288.32 g/mol
Molecular Formula C14H12N2O3S
Exact Mass 288.056864 g/mol