Wiley SpectraBase; SpectraBase Compound ID=H89Bv13q50
http://spectrabase.com/compound/H89Bv13q50 (accessed Aug 05, 2020).

1H,4H,10H-[1]-BENZOXEPINO-[3,4C]-PYRAZOLE
SpectraBase Compound ID H89Bv13q50
InChI InChI=1S/C11H8N2O2/c14-11-7-3-1-2-4-10(7)15-6-9-8(11)5-12-13-9/h1-5H,6H2,(H,12,13)
InChIKey YMBPRCZMGFDZHU-UHFFFAOYSA-N
Mol Weight 200.2 g/mol
Molecular Formula C11H8N2O2
Exact Mass 200.058578 g/mol