Wiley SpectraBase; SpectraBase Compound ID=H7s5V7qOAS
http://spectrabase.com/compound/H7s5V7qOAS (accessed Aug 04, 2020).

2-(o-ACETAMIDOPHENYL)-N-CYCLOPENTYLGLYOXYLAMIDE
SpectraBase Compound ID H7s5V7qOAS
InChI InChI=1S/C15H18N2O3/c1-10(18)16-13-9-5-4-8-12(13)14(19)15(20)17-11-6-2-3-7-11/h4-5,8-9,11H,2-3,6-7H2,1H3,(H,16,18)(H,17,20)
InChIKey YTIXHGXCJDJPQQ-UHFFFAOYSA-N
Mol Weight 274.32 g/mol
Molecular Formula C15H18N2O3
Exact Mass 274.131743 g/mol