Wiley SpectraBase; SpectraBase Compound ID=H7quMuZtWp
http://spectrabase.com/compound/H7quMuZtWp (accessed Sep 20, 2020).

TRANS-1-[(1R,2S)-(2-PHENYLCYCLOHEXYL)-OXY]-1,4-PENTADIENE
SpectraBase Compound ID H7quMuZtWp
InChI InChI=1S/C17H22O/c1-2-3-9-14-18-17-13-8-7-12-16(17)15-10-5-4-6-11-15/h2,4-6,9-11,14,16-17H,1,3,7-8,12-13H2/b14-9+/t16-,17+/m1/s1
InChIKey UCIDQZRLECHMIC-MHWBIKBRSA-N
Mol Weight 242.36 g/mol
Molecular Formula C17H22O
Exact Mass 242.167065 g/mol
Enantiomer InChIKey UCIDQZRLECHMIC-AJRXROEASA-N