Wiley SpectraBase; SpectraBase Compound ID=H6HrcF6VvMX
http://spectrabase.com/compound/H6HrcF6VvMX (accessed Jul 14, 2020).

TRANS-2-N-PROPYL-CYCLOPROPANE-CARBOXYLIC-ACID
SpectraBase Compound ID H6HrcF6VvMX
InChI InChI=1S/C7H12O2/c1-2-3-5-4-6(5)7(8)9/h5-6H,2-4H2,1H3,(H,8,9)/t5-,6-/m0/s1
InChIKey VGXKFXUFNJJDGP-WDSKDSINSA-N
Mol Weight 128.17 g/mol
Molecular Formula C7H12O2
Exact Mass 128.08373 g/mol
Enantiomer InChIKey VGXKFXUFNJJDGP-PHDIDXHHSA-N