Wiley SpectraBase; SpectraBase Compound ID=H4qYLWFv2n
http://spectrabase.com/compound/H4qYLWFv2n (accessed Aug 08, 2020).

8-BETA-METHYL-PODOCARPAN-13-ONE
SpectraBase Compound ID H4qYLWFv2n
InChI InChI=1S/C18H30O/c1-16(2)9-5-10-18(4)14(16)8-11-17(3)12-13(19)6-7-15(17)18/h14-15H,5-12H2,1-4H3/t14-,15-,17-,18-/m0/s1
InChIKey DVPDYEGEWHMSNA-LAQRGFTBSA-N
Mol Weight 262.44 g/mol
Molecular Formula C18H30O
Exact Mass 262.229666 g/mol
Enantiomer InChIKey DVPDYEGEWHMSNA-JOCBIADPSA-N