Wiley SpectraBase; SpectraBase Compound ID=H4RhzBRmIp
http://spectrabase.com/compound/H4RhzBRmIp (accessed Aug 10, 2020).

PARA-DIMETHYLAMINOBENZOIC-ACID-SODIUM-SALT
SpectraBase Compound ID H4RhzBRmIp
InChI InChI=1S/C9H11NO2.Na/c1-10(2)8-5-3-7(4-6-8)9(11)12;/h3-6H,1-2H3,(H,11,12);/q;+1/p-1
InChIKey RNXMNXNEZOUMQV-UHFFFAOYSA-M
Mol Weight 187.17 g/mol
Molecular Formula C9H10NNaO2
Exact Mass 187.060923 g/mol
Parent InChIKey YDIYEOMDOWUDTJ-UHFFFAOYSA-M