Wiley SpectraBase; SpectraBase Compound ID=GxpYhvfOttU
http://spectrabase.com/compound/GxpYhvfOttU (accessed Aug 07, 2020).

2-ACETYL-1,2,3,4,7,8,9,10-OCTAHYDROBENZO-[H]-ISOQUINOLINE-1-CARBONITRILE
SpectraBase Compound ID GxpYhvfOttU
InChI InChI=1S/C16H18N2O/c1-11(19)18-9-8-13-7-6-12-4-2-3-5-14(12)16(13)15(18)10-17/h6-7,15H,2-5,8-9H2,1H3
InChIKey SBWXAHLVHGTKPD-UHFFFAOYSA-N
Mol Weight 254.33 g/mol
Molecular Formula C16H18N2O
Exact Mass 254.141913 g/mol