Wiley SpectraBase; SpectraBase Compound ID=GwvJsDQMWu9
http://spectrabase.com/compound/GwvJsDQMWu9 (accessed Aug 09, 2020).

QEFWYSNUGRKFMM-UHFFFAOYSA-N
SpectraBase Compound ID GwvJsDQMWu9
InChI InChI=1S/C17H18N2OS/c20-17-12-18(10-13-4-2-1-3-5-13)11-15-14-7-9-21-16(14)6-8-19(15)17/h1-5,7,9,15H,6,8,10-12H2
InChIKey QEFWYSNUGRKFMM-UHFFFAOYSA-N
Mol Weight 298.4 g/mol
Molecular Formula C17H18N2OS
Exact Mass 298.113985 g/mol