Wiley SpectraBase; SpectraBase Compound ID=GvnHOHZtd8B
http://spectrabase.com/compound/GvnHOHZtd8B (accessed Sep 27, 2020).

ENDO,EXO-HEXACYCLO-[9.2.1.0(2,10).0(3,8).0(4,6).0(5,9)]-TETRADECANE
SpectraBase Compound ID GvnHOHZtd8B
InChI InChI=1S/C14H18/c1-2-6-3-5(1)9-10(6)12-7-4-8-13(11(7)9)14(8)12/h5-14H,1-4H2/t5-,6+,7+,8?,9-,10+,11-,12+,13-,14+
InChIKey YBNSWVHWZLAYSU-IHXDFNSKSA-N
Mol Weight 186.3 g/mol
Molecular Formula C14H18
Exact Mass 186.140851 g/mol