Wiley SpectraBase; SpectraBase Compound ID=GbzyTJBRJOL
http://spectrabase.com/compound/GbzyTJBRJOL (accessed Oct 24, 2020).

(3A-ALPHA,4-ALPHA,6A-ALPHA)-TETRAHYDRO-4-(4-METHOXY-1-PHENYL)-2',2'-DIMETHYL-FURO-[3.4-D]-1',3'-DIOXOLE
SpectraBase Compound ID GbzyTJBRJOL
InChI InChI=1S/C14H18O4/c1-14(2)17-11-8-16-12(13(11)18-14)9-4-6-10(15-3)7-5-9/h4-7,11-13H,8H2,1-3H3
InChIKey UQBAUFKFYHNUTO-UHFFFAOYSA-N
Mol Weight 250.29 g/mol
Molecular Formula C14H18O4
Exact Mass 250.120509 g/mol