Wiley SpectraBase; SpectraBase Compound ID=F6UsZeZly
http://spectrabase.com/compound/F6UsZeZly (accessed Sep 27, 2020).

SpectraBase Compound ID F6UsZeZly
InChI InChI=1S/C15H14N2O4S/c16-11-3-1-2-4-14(11)22-15(8-17(18)19)10-5-6-12-13(7-10)21-9-20-12/h1-7,15H,8-9,16H2
Mol Weight 318.35 g/mol
Molecular Formula C15H14N2O4S
Exact Mass 318.067429 g/mol