Wiley SpectraBase; SpectraBase Compound ID=EukOj5EG2E1
http://spectrabase.com/compound/EukOj5EG2E1 (accessed Jul 11, 2020).

REFERENCE
SpectraBase Compound ID EukOj5EG2E1
InChI InChI=1S/C14H16N2O/c15-10-11-5-4-8-13(9-11)16-14(17)12-6-2-1-3-7-12/h1-3,6-7,11,13H,4-5,8-9H2,(H,16,17)/t11-,13+/m1/s1
InChIKey RTILKLTXOFEYHK-YPMHNXCESA-N
Mol Weight 228.29 g/mol
Molecular Formula C14H16N2O
Exact Mass 228.126263 g/mol
Enantiomer InChIKey RTILKLTXOFEYHK-WCQYABFASA-N