Wiley SpectraBase; SpectraBase Compound ID=Eu8nmGUYwMG
http://spectrabase.com/compound/Eu8nmGUYwMG (accessed Oct 24, 2020).

6,7-Dihydroxycoumarin-4-acetic acid
SpectraBase Compound ID Eu8nmGUYwMG
InChI InChI=1S/C11H8O6/c12-7-3-6-5(1-10(14)15)2-11(16)17-9(6)4-8(7)13/h2-4,12-13H,1H2,(H,14,15)
InChIKey VZBNZFYHLQRFPS-UHFFFAOYSA-N
Mol Weight 236.18 g/mol
Molecular Formula C11H8O6
Exact Mass 236.032088 g/mol