Wiley SpectraBase; SpectraBase Compound ID=EfHWPdrk0Od
http://spectrabase.com/compound/EfHWPdrk0Od (accessed Aug 07, 2020).

7-METHYL-8A-(4-CHLOROPHENYL)-HEXAHYDROPYRROLO-[2,1-B]-[3,1]-OXAZIN-6-ONE
SpectraBase Compound ID EfHWPdrk0Od
InChI InChI=1S/C14H16ClNO2/c1-10-9-14(11-3-5-12(15)6-4-11)16(13(10)17)7-2-8-18-14/h3-6,10H,2,7-9H2,1H3
InChIKey DFIACSLKBVNDKL-UHFFFAOYSA-N
Mol Weight 265.74 g/mol
Molecular Formula C14H16ClNO2
Exact Mass 265.086957 g/mol