Wiley SpectraBase; SpectraBase Compound ID=EcKbTENCFnt
http://spectrabase.com/compound/EcKbTENCFnt (accessed Jul 15, 2020).

SpectraBase Compound ID EcKbTENCFnt
InChI InChI=1S/C17H20N2O2/c1-17-8-4-7-15(21)19(17)11(10-20)9-13-12-5-2-3-6-14(12)18-16(13)17/h2-3,5-6,11,18,20H,4,7-10H2,1H3/t11-,17-/m0/s1
Mol Weight 284.36 g/mol
Molecular Formula C17H20N2O2
Exact Mass 284.152478 g/mol