Wiley SpectraBase; SpectraBase Compound ID=ESH8Y8aV9CE
http://spectrabase.com/compound/ESH8Y8aV9CE (accessed Jul 11, 2020).

REFERENCE
SpectraBase Compound ID ESH8Y8aV9CE
InChI InChI=1S/C7H12N2/c8-5-6-3-1-2-4-7(6)9/h6-7H,1-4,9H2/t6-,7+/m0/s1
InChIKey RVGOKHBYNZPVGI-NKWVEPMBSA-N
Mol Weight 124.19 g/mol
Molecular Formula C7H12N2
Exact Mass 124.100048 g/mol
Enantiomer InChIKey RVGOKHBYNZPVGI-RQJHMYQMSA-N