Wiley SpectraBase; SpectraBase Compound ID=EOtBdmJX8sL
http://spectrabase.com/compound/EOtBdmJX8sL (accessed Oct 24, 2020).

N,N-DIMETHYL-VINYLAMINE
SpectraBase Compound ID EOtBdmJX8sL
InChI InChI=1S/C4H9N/c1-4-5(2)3/h4H,1H2,2-3H3
InChIKey NINOYJQVULROET-UHFFFAOYSA-N
Mol Weight 71.12 g/mol
Molecular Formula C4H9N
Exact Mass 71.073499 g/mol