Wiley SpectraBase; SpectraBase Compound ID=EGFfX6r5CDn
http://spectrabase.com/compound/EGFfX6r5CDn (accessed Oct 24, 2020).

2-(2-aminoethyl)-1-ethylpyrrolidine
SpectraBase Compound ID EGFfX6r5CDn
InChI InChI=1S/C8H18N2/c1-2-10-7-3-4-8(10)5-6-9/h8H,2-7,9H2,1H3
InChIKey SEYURSMOEWBZSA-UHFFFAOYSA-N
Mol Weight 142.25 g/mol
Molecular Formula C8H18N2
Exact Mass 142.146999 g/mol