Wiley SpectraBase; SpectraBase Compound ID=EA7Tm44sNTG
http://spectrabase.com/compound/EA7Tm44sNTG (accessed Jul 15, 2020).

SpectraBase Compound ID EA7Tm44sNTG
InChI InChI=1S/C12H15ClN2O3/c1-18-11(16)6-9(7-15-12(14)17)8-2-4-10(13)5-3-8/h2-5,9H,6-7H2,1H3,(H3,14,15,17)
Mol Weight 270.72 g/mol
Molecular Formula C12H15ClN2O3
Exact Mass 270.07712 g/mol