SpectraBase Compound ID | E7Nv6oTV3t4 |
---|---|
InChI | InChI=1S/C18H19ClO2/c1-2-17(14-6-4-3-5-7-14)18(20)15-8-10-16(11-9-15)21-13-12-19/h3-11,17H,2,12-13H2,1H3 |
InChIKey | ZUVNHKQPUCOXAA-UHFFFAOYSA-N |
Mol Weight | 302.8 g/mol |
Molecular Formula | C18H19ClO2 |
Exact Mass | 302.107358 g/mol |
Title | Journal or Book | Year |
---|---|---|
10.1139/cjc-77-1-146 | "" | "" |
Search your unknown spectrum against the world's largest collection of reference spectra
Offers every student and faculty member unlimited access to millions of spectra and advanced software