SpectraBase Compound ID | Dr44ml7M2Oo |
---|---|
InChI | InChI=1S/C6H11.K/c1-5(2)6(3)4;/h6H,1-2H2,3-4H3;/i1D;/b5-1+; |
InChIKey | IMZSANXNLNIOHG-LOKXTEDPSA-N |
Mol Weight | 123.26 g/mol |
Molecular Formula | C6H102HK |
Exact Mass | 123.05606 g/mol |
Title | Journal or Book | Year |
---|---|---|
Magnesium-, Lithium- und Kalium-Verbindungen vom Allyl-Typ: σ- oder π-Strukturen? | Angewandte Chemie | 1980 |
Search your unknown spectrum against the world's largest collection of reference spectra
Offers every student and faculty member unlimited access to millions of spectra and advanced software