SpectraBase Compound ID | CsAMSfTCY1d |
---|---|
InChI | InChI=1S/C6H9N3O2S/c1-8-4(10)7-5(11-3)9(2)6(8)12/h1-3H3 |
InChIKey | TYPCFNWBKVXINE-UHFFFAOYSA-N |
Mol Weight | 187.22 g/mol |
Molecular Formula | C6H9N3O2S |
Exact Mass | 187.041548 g/mol |
Title | Journal or Book | Year |
---|---|---|
Indoloquinolizidine alkaloids. A highly stereoselective synthesis of (±)-deplancheine using a dienetricarbonyliron(0) complex | J. Chem. Soc., Perkin Trans. 1 | 1984 |
Search your unknown spectrum against the world's largest collection of reference spectra
Offers every student and faculty member unlimited access to millions of spectra and advanced software