Wiley SpectraBase; SpectraBase Compound ID=CbP44q8pySk
http://spectrabase.com/compound/CbP44q8pySk (accessed Jul 15, 2020).

3-PHENYL-GLUTARIC-ANHYDRIDE
SpectraBase Compound ID CbP44q8pySk
InChI InChI=1S/C11H10O3/c12-10-6-9(7-11(13)14-10)8-4-2-1-3-5-8/h1-5,9H,6-7H2
InChIKey DNWAYXNMUKHONN-UHFFFAOYSA-N
Mol Weight 190.2 g/mol
Molecular Formula C11H10O3
Exact Mass 190.062994 g/mol