SpectraBase Compound ID | CPITqPOKKP |
---|---|
InChI | InChI=1S/C32H22O10/c1-39-17-6-3-15(4-7-17)26-14-25(38)31-23(36)12-22(35)29(32(31)42-26)19-9-16(5-8-20(19)33)27-13-24(37)30-21(34)10-18(40-2)11-28(30)41-27/h3-14,33-36H,1-2H3 |
InChIKey | GZTVUTQZSAZUIY-UHFFFAOYSA-N |
Mol Weight | 566.5 g/mol |
Molecular Formula | C32H22O10 |
Exact Mass | 566.121297 g/mol |
Title | Journal or Book | Year |
---|---|---|
Biflavonoids from Podocalyx loranthoides | Fitoterapia | 2003 |
Search your unknown spectrum against the world's largest collection of reference spectra
Offers every student and faculty member unlimited access to millions of spectra and advanced software