Wiley SpectraBase; SpectraBase Compound ID=C0dqUuJGryw
http://spectrabase.com/compound/C0dqUuJGryw (accessed Oct 24, 2020).

3-(p-METHYL-HYDRAZONO)-METHYL-2-OXO-1,2-DIHYDRO-QUINOXALINE;DIAZENYLAMINE-FORM
SpectraBase Compound ID C0dqUuJGryw
InChI InChI=1S/C16H14N4O/c1-11-6-8-12(9-7-11)20-17-10-15-16(21)19-14-5-3-2-4-13(14)18-15/h2-10,20H,1H3,(H,19,21)/b17-10+
InChIKey NPBXGAKJXSRVKQ-LICLKQGHSA-N
Mol Weight 278.31 g/mol
Molecular Formula C16H14N4O
Exact Mass 278.116761 g/mol