Wiley SpectraBase; SpectraBase Compound ID=BrX9gGhFFVj
http://spectrabase.com/compound/BrX9gGhFFVj (accessed Aug 07, 2020).

DIMETHYL-6,9-DIOXO-CIS-1-TRANSOID-1,2-CIS-2-3,12-DIAZATRICYCLO-[6.4.0.0(2,7)]-DODECAN-3,12-DICARBOXYLAT
SpectraBase Compound ID BrX9gGhFFVj
InChI InChI=1S/C14H18N2O6/c1-21-13(19)15-5-3-7(17)9-10-8(18)4-6-16(14(20)22-2)12(10)11(9)15/h9-12H,3-6H2,1-2H3/t9-,10-,11-,12-/m1/s1
InChIKey OLUCGCLDFDOUTC-DDHJBXDOSA-N
Mol Weight 310.31 g/mol
Molecular Formula C14H18N2O6
Exact Mass 310.116487 g/mol
Enantiomer InChIKey OLUCGCLDFDOUTC-BJDJZHNGSA-N