Wiley SpectraBase; SpectraBase Compound ID=BjkN73ZetFT
http://spectrabase.com/compound/BjkN73ZetFT (accessed Jul 14, 2020).

REFERENCE
SpectraBase Compound ID BjkN73ZetFT
InChI InChI=1S/C15H19NO4/c17-14(18)12-7-4-8-13(9-12)16-15(19)20-10-11-5-2-1-3-6-11/h1-3,5-6,12-13H,4,7-10H2,(H,16,19)(H,17,18)/t12-,13-/m1/s1
InChIKey LTEORMGXUMWZCU-CHWSQXEVSA-N
Mol Weight 277.32 g/mol
Molecular Formula C15H19NO4
Exact Mass 277.131408 g/mol
Enantiomer InChIKey LTEORMGXUMWZCU-STQMWFEESA-N