Wiley SpectraBase; SpectraBase Compound ID=BSjIR85nno7
http://spectrabase.com/compound/BSjIR85nno7 (accessed Sep 27, 2020).

PENTACYCLO-[6.4.0.0(2,6).0(5,9).0(4,12)]-DODECANE
SpectraBase Compound ID BSjIR85nno7
InChI InChI=1S/C12H16/c1-2-6-8-4-10-9-3-7(12(6)10)5(1)11(8)9/h5-12H,1-4H2/t5-,6-,7-,8-,9?,10?,11-,12+/m0/s1
InChIKey CPHUYQRMZGHJOI-KOAYSOERSA-N
Mol Weight 160.26 g/mol
Molecular Formula C12H16
Exact Mass 160.125201 g/mol
Enantiomer InChIKey CPHUYQRMZGHJOI-TZLYHNOWSA-N