SpectraBase Compound ID | BQzj9w1vCiu |
---|---|
InChI | InChI=1S/C21H22O4/c1-13(2)9-10-15-19(24-3)12-17(23)20-16(22)11-18(25-21(15)20)14-7-5-4-6-8-14/h4-9,12,18,23H,10-11H2,1-3H3 |
InChIKey | NISHDQWTPMJBJI-UHFFFAOYSA-N |
Mol Weight | 338.4 g/mol |
Molecular Formula | C21H22O4 |
Exact Mass | 338.151809 g/mol |
Title | Journal or Book | Year |
---|---|---|
Flavonoids of Tephrosia polyphylla | Phytochemistry | 1992 |
Search your unknown spectrum against the world's largest collection of reference spectra
Offers every student and faculty member unlimited access to millions of spectra and advanced software