SpectraBase Compound ID | BLA7a2449Ff |
---|---|
InChI | InChI=1S/C16H16O4/c1-16(2)8-7-10-13(17)9-5-4-6-11(19-3)12(9)14(18)15(10)20-16/h4-6H,7-8H2,1-3H3 |
InChIKey | PZZDIQYEWIHAEX-UHFFFAOYSA-N |
Mol Weight | 272.3 g/mol |
Molecular Formula | C16H16O4 |
Exact Mass | 272.104859 g/mol |
Title | Journal or Book | Year |
---|---|---|
Cytotoxic naphthoquinones from Mansoa alliacea | Phytochemistry | 1992 |
Search your unknown spectrum against the world's largest collection of reference spectra
Offers every student and faculty member unlimited access to millions of spectra and advanced software