Wiley SpectraBase; SpectraBase Compound ID=BJQ7kAePwXP
http://spectrabase.com/compound/BJQ7kAePwXP (accessed Sep 26, 2020).

SpectraBase Compound ID BJQ7kAePwXP
InChI InChI=1S/C8H15N/c1-8-3-2-6(5-8)4-7(8)9/h6-7H,2-5,9H2,1H3/t6-,7+,8-/m0/s1
Mol Weight 125.21 g/mol
Molecular Formula C8H15N
Exact Mass 125.12045 g/mol