Wiley SpectraBase; SpectraBase Compound ID=B6iLNgIpRvL
http://spectrabase.com/compound/B6iLNgIpRvL (accessed Sep 26, 2020).

SpectraBase Compound ID B6iLNgIpRvL
InChI InChI=1S/C17H28/c1-11-5-6-14-8-7-12-3-2-4-13-9-10-15(11)17(14)16(12)13/h11-17H,2-10H2,1H3/t11?,12-,13-,14-,15+,16+,17-/m0/s1
Mol Weight 232.41 g/mol
Molecular Formula C17H28
Exact Mass 232.219101 g/mol