Wiley SpectraBase; SpectraBase Compound ID=AvfEoPl7yMr
http://spectrabase.com/compound/AvfEoPl7yMr (accessed Jul 11, 2020).

REFERENCE
SpectraBase Compound ID AvfEoPl7yMr
InChI InChI=1S/C8H10N2O/c1-3-10-6-4-5-8(10)7(2)9-11/h3-6,11H,1H2,2H3/b9-7-
InChIKey LCGXPKVKUUZZFF-CLFYSBASSA-N
Mol Weight 150.18 g/mol
Molecular Formula C8H10N2O
Exact Mass 150.079313 g/mol