SpectraBase Compound ID | AtiuVT1zSRb |
---|---|
InChI | InChI=1S/C12H12O5/c1-14-9-5-8(3-4-11(13)15-2)6-10-12(9)17-7-16-10/h3-6H,7H2,1-2H3/b4-3+ |
InChIKey | MWZHKQTXZWMJQO-ONEGZZNKSA-N |
Mol Weight | 236.22 g/mol |
Molecular Formula | C12H12O5 |
Exact Mass | 236.068474 g/mol |
Title | Journal or Book | Year |
---|---|---|
2-Alkyl-4-quinolone alkaloids and cinnamic acid derivatives from Esenbeckia almawillia | Phytochemistry | 1994 |
Search your unknown spectrum against the world's largest collection of reference spectra
Offers every student and faculty member unlimited access to millions of spectra and advanced software