Wiley SpectraBase; SpectraBase Compound ID=9PqxmTAdOKZ
http://spectrabase.com/compound/9PqxmTAdOKZ (accessed Jul 15, 2020).

1-(INDOMETHYL)-7-CYANOBICYCLO-[2.2.1]-HEPTANE
SpectraBase Compound ID 9PqxmTAdOKZ
InChI InChI=1S/C9H12IN/c10-6-9-3-1-7(2-4-9)8(9)5-11/h7-8H,1-4,6H2/t7-,8?,9+
InChIKey FLCZGQMFJUTVHY-FZUZSOMASA-N
Mol Weight 261.11 g/mol
Molecular Formula C9H12IN
Exact Mass 261.001451 g/mol