Wiley SpectraBase; SpectraBase Compound ID=9J9YNlt9ME
http://spectrabase.com/compound/9J9YNlt9ME (accessed Oct 24, 2020).

1-(AZIDOMETHYL)-2,4,6-(TRICHLORO)-BENZENE
SpectraBase Compound ID 9J9YNlt9ME
InChI InChI=1S/C7H4Cl3N3/c8-4-1-6(9)5(3-12-13-11)7(10)2-4/h1-2H,3H2
InChIKey NGGACUURUOOCMH-UHFFFAOYSA-N
Mol Weight 236.49 g/mol
Molecular Formula C7H4Cl3N3
Exact Mass 234.94708 g/mol