Wiley SpectraBase; SpectraBase Compound ID=9EhnLeA2JP0
http://spectrabase.com/compound/9EhnLeA2JP0 (accessed Jul 15, 2020).

SpectraBase Compound ID 9EhnLeA2JP0
InChI InChI=1S/C8H14O/c1-8-3-2-6(5-8)4-7(8)9/h6-7,9H,2-5H2,1H3/t6-,7-,8-/m0/s1
Mol Weight 126.2 g/mol
Molecular Formula C8H14O
Exact Mass 126.104465 g/mol