Wiley SpectraBase; SpectraBase Compound ID=99uavlE72Zj
http://spectrabase.com/compound/99uavlE72Zj (accessed Sep 25, 2020).

[2-(7-dioxidoazaniumylidene-5-nitro-3-oxido-4H-benzofurazan-3-ium-4-yl)-3-thienyl]-methyl-ammonium
SpectraBase Compound ID 99uavlE72Zj
InChI InChI=1S/C11H8N5O6S/c1-12-5-2-3-23-11(5)8-6(14(17)18)4-7(15(19)20)9-10(8)16(21)22-13-9/h2-4,8,12H,1H3/q-1/p+1
InChIKey PZAVRTZEKSHQOF-UHFFFAOYSA-O
Mol Weight 339.28 g/mol
Molecular Formula C11H9N5O6S
Exact Mass 339.027355 g/mol