Wiley SpectraBase; SpectraBase Compound ID=8vNEwEqGjtB
http://spectrabase.com/compound/8vNEwEqGjtB (accessed Aug 07, 2020).

VTPAQAHDAZSWIW-WDEREUQCSA-N
SpectraBase Compound ID 8vNEwEqGjtB
InChI InChI=1S/C14H23NO3/c1-13(2)9-18-14(7-5-4-6-8-14)15-11(13)10(17-3)12(15)16/h10-11H,4-9H2,1-3H3/t10-,11+/m0/s1
InChIKey VTPAQAHDAZSWIW-WDEREUQCSA-N
Mol Weight 253.34 g/mol
Molecular Formula C14H23NO3
Exact Mass 253.167794 g/mol
Enantiomer InChIKey VTPAQAHDAZSWIW-MNOVXSKESA-N