Wiley SpectraBase; SpectraBase Compound ID=8eAcEZuiHiz
http://spectrabase.com/compound/8eAcEZuiHiz (accessed Sep 27, 2020).

SpectraBase Compound ID 8eAcEZuiHiz
InChI InChI=1S/C8H14O/c1-8(9)5-6-2-3-7(8)4-6/h6-7,9H,2-5H2,1H3/t6-,7+,8+/m1/s1
Mol Weight 126.2 g/mol
Molecular Formula C8H14O
Exact Mass 126.104465 g/mol