SpectraBase Compound ID | 8UUa3boARQ3 |
---|---|
InChI | InChI=1S/C19H16N4O/c24-19-21-18-17(13-22(19)11-15-7-3-1-4-8-15)23(14-20-18)12-16-9-5-2-6-10-16/h1-10,13-14H,11-12H2 |
InChIKey | AAHSXUATHLOPNI-UHFFFAOYSA-N |
Mol Weight | 316.36 g/mol |
Molecular Formula | C19H16N4O |
Exact Mass | 316.132411 g/mol |
Title | Journal or Book | Year |
---|---|---|
Alkylation and Convalent Adduct Formation of 2-Oxopurine | HETEROCYCLES | 1993 |
Search your unknown spectrum against the world's largest collection of reference spectra
Offers every student and faculty member unlimited access to millions of spectra and advanced software